Smiles Code
C[C@@H](NC(=O)OCC1c2ccccc2c3ccccc13)C(=O)O
DMF (Slightly), DMSO (Slightly), Methanol (Slightly)
Building Blocks; Chiral Molecules; Amino Acids; Pharmaceutical/API Drug Impurities/Metabolites;
N-Fmoc-D-alanine is the N-Fmoc-protected form of D-Alanine (A480995). D-Alanine is an amino acid that is commonly found in bacteria, such as Streptococcus faecalis. It is essential for the biosynthesis of peptidoglycan crosslinking sub-units that are used for bacterial cell walls. D-Alanine is also known to cause cytotoxic oxidative stress in brain tumour cells.